A white to yellow powder, this water-soluble starch derivative serves as a thickener or filler in food and beverages, a carbohydrate source in sports nutrition products, and a binder in pharmaceutical formulations. It features a neutral taste and high digestibility.
Maltodextrin Chemical Properties
| Melting point | 240 °C (dec.) (lit.) |
| Density | 1.81 g/cm3 |
| Refractive index | 1.673 |
| Storage temp | Room temp |
| Solubility | H2O: 0.1 g/mL hot, complete, yellow to very deep yellow |
| Form | Powder |
| Odor | At 100.00?%. odorless |
| biological source | maize |
| InChI | InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3?,4?,5-,6?,7?,8?,9?, 10-,11+,12-/s3 |
| InChIKey | GUBGYTABKSRVRQ-CKGNGCRFNA-N |
| SMILES | C1(CO)O[C@H](O[C@H]2C(O)C(O)[C@@H](O)OC2CO)C(O)C(O)[C@@H]1O |&1:4,6,11,21,r| |
| LogP | -4.673 (est) |
| CAS DataBase Reference | 9050-36-6 |
| EPA Substance Registry System | Maltodextrin (9050-36-6) |
Application of Maltodextrin (CAS#9050-36-6)
Maltodextrin is utilized as a stabilizer in processed foods, an energy-boosting ingredient in sports supplements, a bulking agent in pharmaceutical formulations, and a texture-enhancing additive in cosmetic products.
