Products Description of Sodium Hexafluorophosphate CAS#21324-39-0
Sodium hexafluorophosphate, alternatively called sodium hexafluorophosphate(V), carries the chemical formula NaPF₆·H₂O with a molecular weight of 185.97. This substance appears as a white powder and has a relative density of 2.36919, with great solubility in water. It is sensitive to ambient air and carbon dioxide, and will undergo decomposition under high-temperature conditions. One preparation method involves the slow dropwise addition of PCl₅ into aqueous HF solution containing sodium chloride.
Sodium hexafluorophosphate Chemical Properties
| Melting point | >200 °C (lit.) |
| density | 2.369 g/mL at 25 °C (lit.) |
| solubility | H2O: soluble5%, clear, colorless |
| form | Crystals |
| Specific Gravity | 3.375 |
| color | White to light gray |
| PH | 2.0-4.0 |
| Water Solubility | SOLUBLE |
| Sensitive | Hygroscopic |
| Stability: | Stable. Incompatible with strong acids. |
| InChI | InChI=1S/F6P.Na/c1-7(2,3,4,5)6;/q-1;+1 |
| InChIKey | KMADQUOCJBLXRP-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[Na+] |
| CAS DataBase Reference | 21324-39-0(CAS DataBase Reference) |
| Hazard Codes | C,Xi |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3260 8/PG 2 |
| WGK Germany | 3 |
| F | 46091 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 28269090 |
Product Application of Sodium Hexafluorophosphate CAS#21324-39-0
Sodium hexafluorophosphate mainly functions as a starting material and synthetic intermediate for manufacturing other hexafluorophosphate derivatives.
